C33H16BF18N6- — CID 139167633
tris[3-(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]boranuide (PubChem CID 139167633) has the molecular formula C33H16BF18N6- and a molecular weight of 849.31 g/mol. Its IUPAC name is tris[3-(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]boranuide.
| Compound Name | tris[3-(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]boranuide |
|---|---|
| PubChem CID | 139167633 |
| Molecular Formula | C33H16BF18N6- |
| Molecular Weight | 849.31 g/mol |
| Exact Mass | 849.12 |
| IUPAC Name | tris[3-(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]pyrazol-1-yl]boranuide |
| SMILES | FC(F)(F)c1ccc(-c2cc(C(F)(F)F)nn2[BH-](n2nc(C(F)(F)F)cc2-c2ccc(C(F)(F)F)cc2)n2nc(C(F)(F)F)cc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H16BF18N6/c35-28(36,37)19-7-1-16(2-8-19)22-13-25(31(44,45)46)53-56(22)34(57-23(14-26(54-57)32(47,48)49)17-3-9-20(10-4-17)29(38,39)40)58-24(15-27(55-58)33(50,51)52)18-5-11-21(12-6-18)30(41,42)43/h1-15,34H/q-1 |
| InChIKey | NWQHNSGYEGPBPF-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.31 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|