C22H33NO3Si — CID 134901436
tert-butyl (4S)-2,2-dimethyl-4-[(1S)-1-phenyl-3-trimethylsilylprop-2-ynyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 134901436) has the molecular formula C22H33NO3Si and a molecular weight of 387.60 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[(1S)-1-phenyl-3-trimethylsilylprop-2-ynyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[(1S)-1-phenyl-3-trimethylsilylprop-2-ynyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 134901436 |
| Molecular Formula | C22H33NO3Si |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[(1S)-1-phenyl-3-trimethylsilylprop-2-ynyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]([C@H](C#C[Si](C)(C)C)c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C22H33NO3Si/c1-21(2,3)26-20(24)23-19(16-25-22(23,4)5)18(14-15-27(6,7)8)17-12-10-9-11-13-17/h9-13,18-19H,16H2,1-8H3/t18-,19-/m1/s1 |
| InChIKey | APCXQPGRHJYAHJ-RTBURBONSA-N |
| XLogP | 5.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|