C12H20O3 — CID 134901682
2-(3,3-diethoxyprop-1-en-2-yl)cyclopent-3-en-1-ol (PubChem CID 134901682) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-(3,3-diethoxyprop-1-en-2-yl)cyclopent-3-en-1-ol.
| Compound Name | 2-(3,3-diethoxyprop-1-en-2-yl)cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 134901682 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-(3,3-diethoxyprop-1-en-2-yl)cyclopent-3-en-1-ol |
| SMILES | C=C(C(OCC)OCC)C1C=CCC1O |
| InChI | InChI=1S/C12H20O3/c1-4-14-12(15-5-2)9(3)10-7-6-8-11(10)13/h6-7,10-13H,3-5,8H2,1-2H3 |
| InChIKey | SIRFGSQOTHVERA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|