C20H41B — CID 134903580
[(Z)-2,2-dimethyloct-3-en-3-yl]-bis(3-methylbutan-2-yl)borane (PubChem CID 134903580) has the molecular formula C20H41B and a molecular weight of 292.36 g/mol. Its IUPAC name is [(Z)-2,2-dimethyloct-3-en-3-yl]-bis(3-methylbutan-2-yl)borane.
| Compound Name | [(Z)-2,2-dimethyloct-3-en-3-yl]-bis(3-methylbutan-2-yl)borane |
|---|---|
| PubChem CID | 134903580 |
| Molecular Formula | C20H41B |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.33 |
| IUPAC Name | [(Z)-2,2-dimethyloct-3-en-3-yl]-bis(3-methylbutan-2-yl)borane |
| SMILES | CCCC/C=C(/B(C(C)C(C)C)C(C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H41B/c1-11-12-13-14-19(20(8,9)10)21(17(6)15(2)3)18(7)16(4)5/h14-18H,11-13H2,1-10H3/b19-14+ |
| InChIKey | OTLOADHJKIRDRY-XMHGGMMESA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|