C21H41B — CID 134881357
[(3E)-4,8-dimethylnona-3,7-dienyl]-bis(3-methylbutan-2-yl)borane (PubChem CID 134881357) has the molecular formula C21H41B and a molecular weight of 304.37 g/mol. Its IUPAC name is [(3E)-4,8-dimethylnona-3,7-dienyl]-bis(3-methylbutan-2-yl)borane.
| Compound Name | [(3E)-4,8-dimethylnona-3,7-dienyl]-bis(3-methylbutan-2-yl)borane |
|---|---|
| PubChem CID | 134881357 |
| Molecular Formula | C21H41B |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.33 |
| IUPAC Name | [(3E)-4,8-dimethylnona-3,7-dienyl]-bis(3-methylbutan-2-yl)borane |
| SMILES | CC(C)=CCC/C(C)=C/CCB(C(C)C(C)C)C(C)C(C)C |
| InChI | InChI=1S/C21H41B/c1-16(2)12-10-13-19(7)14-11-15-22(20(8)17(3)4)21(9)18(5)6/h12,14,17-18,20-21H,10-11,13,15H2,1-9H3/b19-14+ |
| InChIKey | MWVRJQDGDVXHEC-XMHGGMMESA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|