C30H48 — CID 153280933
(1Z,5Z,9Z,13Z,17Z,21Z)-1,5,9,13,17,21-hexamethylcyclotetracosa-1,5,9,13,17,21-hexaene (PubChem CID 153280933) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is (1Z,5Z,9Z,13Z,17Z,21Z)-1,5,9,13,17,21-hexamethylcyclotetracosa-1,5,9,13,17,21-hexaene.
| Compound Name | (1Z,5Z,9Z,13Z,17Z,21Z)-1,5,9,13,17,21-hexamethylcyclotetracosa-1,5,9,13,17,21-hexaene |
|---|---|
| PubChem CID | 153280933 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | (1Z,5Z,9Z,13Z,17Z,21Z)-1,5,9,13,17,21-hexamethylcyclotetracosa-1,5,9,13,17,21-hexaene |
| SMILES | C/C1=C/CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC1 |
| InChI | InChI=1S/C30H48/c1-25-13-7-15-26(2)17-9-19-28(4)21-11-23-30(6)24-12-22-29(5)20-10-18-27(3)16-8-14-25/h13,16-17,20-21,24H,7-12,14-15,18-19,22-23H2,1-6H3/b25-13-,26-17-,27-16-,28-21-,29-20-,30-24- |
| InChIKey | WSUOURBTDCUBEX-YPOQHXKCSA-N |
| XLogP | 10.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|