C15H27BO3 — CID 134903855
2-[[(3R,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 134903855) has the molecular formula C15H27BO3 and a molecular weight of 266.19 g/mol. Its IUPAC name is 2-[[(3R,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[[(3R,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134903855 |
| Molecular Formula | C15H27BO3 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2-[[(3R,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-3-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C[C@H]2CO[C@H]3CCCC[C@@H]23)OC1(C)C |
| InChI | InChI=1S/C15H27BO3/c1-14(2)15(3,4)19-16(18-14)9-11-10-17-13-8-6-5-7-12(11)13/h11-13H,5-10H2,1-4H3/t11-,12-,13-/m0/s1 |
| InChIKey | QJJYOTASECWCMD-AVGNSLFASA-N |
| XLogP | 3.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|