C17H24O2S — CID 134904501
S-benzyl (2S,3S)-3-cyclohexyl-3-hydroxy-2-methylpropanethioate (PubChem CID 134904501) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is S-benzyl (2S,3S)-3-cyclohexyl-3-hydroxy-2-methylpropanethioate.
| Compound Name | S-benzyl (2S,3S)-3-cyclohexyl-3-hydroxy-2-methylpropanethioate |
|---|---|
| PubChem CID | 134904501 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | S-benzyl (2S,3S)-3-cyclohexyl-3-hydroxy-2-methylpropanethioate |
| SMILES | C[C@H](C(=O)SCc1ccccc1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C17H24O2S/c1-13(16(18)15-10-6-3-7-11-15)17(19)20-12-14-8-4-2-5-9-14/h2,4-5,8-9,13,15-16,18H,3,6-7,10-12H2,1H3/t13-,16+/m0/s1 |
| InChIKey | KEOYKEKSVOQRAY-XJKSGUPXSA-N |
| XLogP | 4.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|