C16H22O5 — CID 134904811
[(2R,3S,6R)-2-acetyloxy-6-(cyclohexen-1-ylmethyl)-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 134904811) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [(2R,3S,6R)-2-acetyloxy-6-(cyclohexen-1-ylmethyl)-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2R,3S,6R)-2-acetyloxy-6-(cyclohexen-1-ylmethyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 134904811 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(2R,3S,6R)-2-acetyloxy-6-(cyclohexen-1-ylmethyl)-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H](CC2=CCCCC2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H22O5/c1-11(17)19-15-9-8-14(21-16(15)20-12(2)18)10-13-6-4-3-5-7-13/h6,8-9,14-16H,3-5,7,10H2,1-2H3/t14-,15-,16-/m0/s1 |
| InChIKey | YWHHDIGETJCNCU-JYJNAYRXSA-N |
| XLogP | 2.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|