C32H35NO6 — CID 134831419
9H-fluoren-9-ylmethyl (2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-6-(cyclohexen-1-ylmethyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134831419) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-6-(cyclohexen-1-ylmethyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl (2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-6-(cyclohexen-1-ylmethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134831419 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2R,3S,6S)-3-acetyloxy-2-(acetyloxymethyl)-6-(cyclohexen-1-ylmethyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](OC(C)=O)C=C[C@H](CC2=CCCCC2)N1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H35NO6/c1-21(34)37-20-30-31(39-22(2)35)17-16-24(18-23-10-4-3-5-11-23)33(30)32(36)38-19-29-27-14-8-6-12-25(27)26-13-7-9-15-28(26)29/h6-10,12-17,24,29-31H,3-5,11,18-20H2,1-2H3/t24-,30-,31+/m1/s1 |
| InChIKey | GHQGOPOTKJBTFF-PKKYCPKDSA-N |
| XLogP | 5.93 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|