C26H31NOSn — CID 134904816
N,N-diethyl-1-tris(4-methylphenyl)stannylformamide (PubChem CID 134904816) has the molecular formula C26H31NOSn and a molecular weight of 492.25 g/mol. Its IUPAC name is N,N-diethyl-1-tris(4-methylphenyl)stannylformamide.
| Compound Name | N,N-diethyl-1-tris(4-methylphenyl)stannylformamide |
|---|---|
| PubChem CID | 134904816 |
| Molecular Formula | C26H31NOSn |
| Molecular Weight | 492.25 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N,N-diethyl-1-tris(4-methylphenyl)stannylformamide |
| SMILES | CCN(CC)C(=O)[Sn](c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/3C7H7.C5H10NO.Sn/c3*1-7-5-3-2-4-6-7;1-3-6(4-2)5-7;/h3*3-6H,1H3;3-4H2,1-2H3; |
| InChIKey | FYODZZAWPAPWSW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |