C23H25GeNO2 — CID 16716277
triphenylgermyl N,N-diethylcarbamate (PubChem CID 16716277) has the molecular formula C23H25GeNO2 and a molecular weight of 420.07 g/mol. Its IUPAC name is triphenylgermyl N,N-diethylcarbamate.
| Compound Name | triphenylgermyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 16716277 |
| Molecular Formula | C23H25GeNO2 |
| Molecular Weight | 420.07 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | triphenylgermyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[Ge](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25GeNO2/c1-3-25(4-2)23(26)27-24(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19H,3-4H2,1-2H3 |
| InChIKey | HETQYXSPLVESNI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.07 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |