C23H25NOSn — CID 134904800
N,N-diethyl-1-triphenylstannylformamide (PubChem CID 134904800) has the molecular formula C23H25NOSn and a molecular weight of 450.17 g/mol. Its IUPAC name is N,N-diethyl-1-triphenylstannylformamide.
| Compound Name | N,N-diethyl-1-triphenylstannylformamide |
|---|---|
| PubChem CID | 134904800 |
| Molecular Formula | C23H25NOSn |
| Molecular Weight | 450.17 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N,N-diethyl-1-triphenylstannylformamide |
| SMILES | CCN(CC)C(=O)[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C6H5.C5H10NO.Sn/c3*1-2-4-6-5-3-1;1-3-6(4-2)5-7;/h3*1-5H;3-4H2,1-2H3; |
| InChIKey | PIWRXXJDUNIJTH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.17 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |