C18H22NOP — CID 22184277
2-diphenylphosphanyl-N,N-diethylacetamide (PubChem CID 22184277) has the molecular formula C18H22NOP and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-diphenylphosphanyl-N,N-diethylacetamide.
| Compound Name | 2-diphenylphosphanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 22184277 |
| Molecular Formula | C18H22NOP |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-diphenylphosphanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22NOP/c1-3-19(4-2)18(20)15-21(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | DSBQGPYRQSXRNR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|