C16H20NOP — CID 796914
2-diphenylphosphoryl-N,N-dimethylethanamine (PubChem CID 796914) has the molecular formula C16H20NOP and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N,N-dimethylethanamine.
| Compound Name | 2-diphenylphosphoryl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 796914 |
| Molecular Formula | C16H20NOP |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-diphenylphosphoryl-N,N-dimethylethanamine |
| SMILES | CN(C)CCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H20NOP/c1-17(2)13-14-19(18,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | WTFJMSFVGMRGBQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|