About 2-diphenylphosphoryl-N,N-dimethylethanamine
2-diphenylphosphoryl-N,N-dimethylethanamine (PubChem CID 796914) has the molecular formula C16H20NOP
and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-diphenylphosphoryl-N,N-dimethylethanamine |
| PubChem CID | 796914 |
| Molecular Formula | C16H20NOP |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-diphenylphosphoryl-N,N-dimethylethanamine |
| SMILES | CN(C)CCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H20NOP/c1-17(2)13-14-19(18,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | WTFJMSFVGMRGBQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diphenylphosphoryl-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diphenylphosphoryl-N,N-dimethylethanamine?
The IUPAC name of 2-diphenylphosphoryl-N,N-dimethylethanamine (CID 796914) is 2-diphenylphosphoryl-N,N-dimethylethanamine.
What is the SMILES notation for 2-diphenylphosphoryl-N,N-dimethylethanamine?
The canonical SMILES for 2-diphenylphosphoryl-N,N-dimethylethanamine is CN(C)CCP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-diphenylphosphoryl-N,N-dimethylethanamine?
The InChIKey is WTFJMSFVGMRGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20NOP/c1-17(2)13-14-19(18,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3.
What are the key properties of 2-diphenylphosphoryl-N,N-dimethylethanamine?
2-diphenylphosphoryl-N,N-dimethylethanamine has a molecular weight of 273.32 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylphosphoryl-N,N-dimethylethanamine is sourced from PubChem (CID 796914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).