C17H20NO2P — CID 12793809
diphenylphosphanyl N,N-diethylcarbamate (PubChem CID 12793809) has the molecular formula C17H20NO2P and a molecular weight of 301.33 g/mol. Its IUPAC name is diphenylphosphanyl N,N-diethylcarbamate.
| Compound Name | diphenylphosphanyl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 12793809 |
| Molecular Formula | C17H20NO2P |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | diphenylphosphanyl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20NO2P/c1-3-18(4-2)17(19)20-21(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | NCBNGFFLDUCWRI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|