C22H30N2O4Si — CID 138454603
[diethylcarbamoyloxy(diphenyl)silyl] N,N-diethylcarbamate (PubChem CID 138454603) has the molecular formula C22H30N2O4Si and a molecular weight of 414.58 g/mol. Its IUPAC name is [diethylcarbamoyloxy(diphenyl)silyl] N,N-diethylcarbamate.
| Compound Name | [diethylcarbamoyloxy(diphenyl)silyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 138454603 |
| Molecular Formula | C22H30N2O4Si |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [diethylcarbamoyloxy(diphenyl)silyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O[Si](OC(=O)N(CC)CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O4Si/c1-5-23(6-2)21(25)27-29(19-15-11-9-12-16-19,20-17-13-10-14-18-20)28-22(26)24(7-3)8-4/h9-18H,5-8H2,1-4H3 |
| InChIKey | WSUZPNZQMIPFFR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|