C39H74FNO7Si6 — CID 177125346
N,N-bis[3-[[4-[dimethyl(3-trimethoxysilylpropyl)silyl]phenyl]-dimethylsilyl]propyl]carbamoyl fluoride (PubChem CID 177125346) has the molecular formula C39H74FNO7Si6 and a molecular weight of 856.53 g/mol. Its IUPAC name is N,N-bis[3-[[4-[dimethyl(3-trimethoxysilylpropyl)silyl]phenyl]-dimethylsilyl]propyl]carbamoyl fluoride.
| Compound Name | N,N-bis[3-[[4-[dimethyl(3-trimethoxysilylpropyl)silyl]phenyl]-dimethylsilyl]propyl]carbamoyl fluoride |
|---|---|
| PubChem CID | 177125346 |
| Molecular Formula | C39H74FNO7Si6 |
| Molecular Weight | 856.53 g/mol |
| Exact Mass | 855.41 |
| IUPAC Name | N,N-bis[3-[[4-[dimethyl(3-trimethoxysilylpropyl)silyl]phenyl]-dimethylsilyl]propyl]carbamoyl fluoride |
| SMILES | CO[Si](CCC[Si](C)(C)c1ccc([Si](C)(C)CCCN(CCC[Si](C)(C)c2ccc([Si](C)(C)CCC[Si](OC)(OC)OC)cc2)C(=O)F)cc1)(OC)OC |
| InChI | InChI=1S/C39H74FNO7Si6/c1-43-53(44-2,45-3)33-17-31-51(11,12)37-23-19-35(20-24-37)49(7,8)29-15-27-41(39(40)42)28-16-30-50(9,10)36-21-25-38(26-22-36)52(13,14)32-18-34-54(46-4,47-5)48-6/h19-26H,15-18,27-34H2,1-14H3 |
| InChIKey | QMHUUWWTRBEXQC-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.53 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|