C41H78FNO7Si6 — CID 177125282
N,N-bis[3-[[4-[ethyl-methyl-(3-trimethoxysilylpropyl)silyl]phenyl]-dimethylsilyl]propyl]carbamoyl fluoride (PubChem CID 177125282) has the molecular formula C41H78FNO7Si6 and a molecular weight of 884.59 g/mol. Its IUPAC name is N,N-bis[3-[[4-[ethyl-methyl-(3-trimethoxysilylpropyl)silyl]phenyl]-dimethylsilyl]propyl]carbamoyl fluoride.
| Compound Name | N,N-bis[3-[[4-[ethyl-methyl-(3-trimethoxysilylpropyl)silyl]phenyl]-dimethylsilyl]propyl]carbamoyl fluoride |
|---|---|
| PubChem CID | 177125282 |
| Molecular Formula | C41H78FNO7Si6 |
| Molecular Weight | 884.59 g/mol |
| Exact Mass | 883.44 |
| IUPAC Name | N,N-bis[3-[[4-[ethyl-methyl-(3-trimethoxysilylpropyl)silyl]phenyl]-dimethylsilyl]propyl]carbamoyl fluoride |
| SMILES | CC[Si](C)(CCC[Si](OC)(OC)OC)c1ccc([Si](C)(C)CCCN(CCC[Si](C)(C)c2ccc([Si](C)(CC)CCC[Si](OC)(OC)OC)cc2)C(=O)F)cc1 |
| InChI | InChI=1S/C41H78FNO7Si6/c1-15-53(13,33-19-35-55(45-3,46-4)47-5)39-25-21-37(22-26-39)51(9,10)31-17-29-43(41(42)44)30-18-32-52(11,12)38-23-27-40(28-24-38)54(14,16-2)34-20-36-56(48-6,49-7)50-8/h21-28H,15-20,29-36H2,1-14H3 |
| InChIKey | ZPUJLJVLPFEKKX-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.59 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|