About CID 134904999
CID 134904999 (PubChem CID 134904999) has the molecular formula C6H12B
and a molecular weight of 94.97 g/mol.
Molecular Properties
| Compound Name | CID 134904999 |
| PubChem CID | 134904999 |
| Molecular Formula | C6H12B |
| Molecular Weight | 94.97 g/mol |
| Exact Mass | 95.10 |
| IUPAC Name | — |
| SMILES | C[C@@H]1[B][C@H](C)CC1 |
| InChI | InChI=1S/C6H12B/c1-5-3-4-6(2)7-5/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | YENPBCWYZBYDCH-OLQVQODUSA-N |
| XLogP | 2.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.97 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 134904999 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134904999?
The IUPAC name of CID 134904999 (CID 134904999) is not available.
What is the SMILES notation for CID 134904999?
The canonical SMILES for CID 134904999 is C[C@@H]1[B][C@H](C)CC1.
What is the InChIKey of CID 134904999?
The InChIKey is YENPBCWYZBYDCH-OLQVQODUSA-N. The full InChI is InChI=1S/C6H12B/c1-5-3-4-6(2)7-5/h5-6H,3-4H2,1-2H3/t5-,6+.
What are the key properties of CID 134904999?
CID 134904999 has a molecular weight of 94.97 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134904999 is sourced from PubChem (CID 134904999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).