About CID 144820013
CID 144820013 (PubChem CID 144820013) has the molecular formula C5H11BN
and a molecular weight of 95.96 g/mol.
Molecular Properties
| Compound Name | CID 144820013 |
| PubChem CID | 144820013 |
| Molecular Formula | C5H11BN |
| Molecular Weight | 95.96 g/mol |
| Exact Mass | 96.10 |
| IUPAC Name | — |
| SMILES | CC1[B]C(C)NC1 |
| InChI | InChI=1S/C5H11BN/c1-4-3-7-5(2)6-4/h4-5,7H,3H2,1-2H3 |
| InChIKey | QWRCLQDPQUNHJD-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.96 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 144820013 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144820013?
The IUPAC name of CID 144820013 (CID 144820013) is not available.
What is the SMILES notation for CID 144820013?
The canonical SMILES for CID 144820013 is CC1[B]C(C)NC1.
What is the InChIKey of CID 144820013?
The InChIKey is QWRCLQDPQUNHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11BN/c1-4-3-7-5(2)6-4/h4-5,7H,3H2,1-2H3.
What are the key properties of CID 144820013?
CID 144820013 has a molecular weight of 95.96 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144820013 is sourced from PubChem (CID 144820013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).