C17H21NO4 — CID 134905181
methyl 3-(1-benzyl-2-methoxy-3-methyl-5-oxopyrrol-2-yl)propanoate (PubChem CID 134905181) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl 3-(1-benzyl-2-methoxy-3-methyl-5-oxopyrrol-2-yl)propanoate.
| Compound Name | methyl 3-(1-benzyl-2-methoxy-3-methyl-5-oxopyrrol-2-yl)propanoate |
|---|---|
| PubChem CID | 134905181 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl 3-(1-benzyl-2-methoxy-3-methyl-5-oxopyrrol-2-yl)propanoate |
| SMILES | COC(=O)CCC1(OC)C(C)=CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-13-11-15(19)18(12-14-7-5-4-6-8-14)17(13,22-3)10-9-16(20)21-2/h4-8,11H,9-10,12H2,1-3H3 |
| InChIKey | HJQRSXJMHNJZIO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |