About CID 134905932
CID 134905932 (PubChem CID 134905932) has the molecular formula C10H10Be
and a molecular weight of 139.20 g/mol.
Molecular Properties
| Compound Name | CID 134905932 |
| PubChem CID | 134905932 |
| Molecular Formula | C10H10Be |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | — |
| SMILES | [Be].[CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/2C5H5.Be/c2*1-2-4-5-3-1;/h2*1-5H; |
| InChIKey | UOWMVHJMWSANFP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 134905932 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134905932?
The IUPAC name of CID 134905932 (CID 134905932) is not available.
What is the SMILES notation for CID 134905932?
The canonical SMILES for CID 134905932 is [Be].[CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 134905932?
The InChIKey is UOWMVHJMWSANFP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Be/c2*1-2-4-5-3-1;/h2*1-5H;.
What are the key properties of CID 134905932?
CID 134905932 has a molecular weight of 139.20 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134905932 is sourced from PubChem (CID 134905932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).