About CID 11804989
CID 11804989 (PubChem CID 11804989) has the molecular formula C10H10Mg+2
and a molecular weight of 154.50 g/mol.
Molecular Properties
| Compound Name | CID 11804989 |
| PubChem CID | 11804989 |
| Molecular Formula | C10H10Mg+2 |
| Molecular Weight | 154.50 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Mg+2] |
| InChI | InChI=1S/2C5H5.Mg/c2*1-2-4-5-3-1;/h2*1-5H;/q;;+2 |
| InChIKey | HLMXIEAUQRRPST-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 11804989 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11804989?
The IUPAC name of CID 11804989 (CID 11804989) is not available.
What is the SMILES notation for CID 11804989?
The canonical SMILES for CID 11804989 is [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Mg+2].
What is the InChIKey of CID 11804989?
The InChIKey is HLMXIEAUQRRPST-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.Mg/c2*1-2-4-5-3-1;/h2*1-5H;/q;;+2.
What are the key properties of CID 11804989?
CID 11804989 has a molecular weight of 154.50 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11804989 is sourced from PubChem (CID 11804989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).