C21H36O3 — CID 134906274
(1R,2R,3aS,5E,6aS)-1-[(E,3S)-3-hydroxyoct-1-enyl]-5-(5-hydroxypentylidene)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 134906274) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is (1R,2R,3aS,5E,6aS)-1-[(E,3S)-3-hydroxyoct-1-enyl]-5-(5-hydroxypentylidene)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | (1R,2R,3aS,5E,6aS)-1-[(E,3S)-3-hydroxyoct-1-enyl]-5-(5-hydroxypentylidene)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 134906274 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | (1R,2R,3aS,5E,6aS)-1-[(E,3S)-3-hydroxyoct-1-enyl]-5-(5-hydroxypentylidene)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2C/C(=C/CCCCO)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C21H36O3/c1-2-3-5-9-18(23)10-11-19-20-14-16(8-6-4-7-12-22)13-17(20)15-21(19)24/h8,10-11,17-24H,2-7,9,12-15H2,1H3/b11-10+,16-8+/t17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | KIQUTIYQKZZCSJ-GFRASHEKSA-N |
| XLogP | 3.98 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|