C25H43BS — CID 134906475
thian-3-yl-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 134906475) has the molecular formula C25H43BS and a molecular weight of 386.50 g/mol. Its IUPAC name is thian-3-yl-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | thian-3-yl-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 134906475 |
| Molecular Formula | C25H43BS |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | thian-3-yl-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1B(C1CCCSC1)[C@@H]1C[C@@H]3C[C@H]([C@H]1C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C25H43BS/c1-15-20-10-17(24(20,3)4)12-22(15)26(19-8-7-9-27-14-19)23-13-18-11-21(16(23)2)25(18,5)6/h15-23H,7-14H2,1-6H3/t15-,16-,17+,18+,19?,20-,21-,22-,23-/m1/s1 |
| InChIKey | WBESTMMBOBOJGT-FHFUEXIGSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|