C24H41BS — CID 134906389
thiolan-3-yl-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane (PubChem CID 134906389) has the molecular formula C24H41BS and a molecular weight of 372.47 g/mol. Its IUPAC name is thiolan-3-yl-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | thiolan-3-yl-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 134906389 |
| Molecular Formula | C24H41BS |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | thiolan-3-yl-bis[(1R,2S,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1B(C1CCSC1)[C@@H]1C[C@@H]3C[C@H]([C@H]1C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C24H41BS/c1-14-19-9-16(23(19,3)4)11-21(14)25(18-7-8-26-13-18)22-12-17-10-20(15(22)2)24(17,5)6/h14-22H,7-13H2,1-6H3/t14-,15-,16+,17+,18?,19-,20-,21-,22-/m1/s1 |
| InChIKey | XYSRKYLMNKRTPR-WMHMBJQOSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|