C14H23S+ — CID 3009957
1'-methylspiro[adamantane-2,3'-thiolan-1-ium] (PubChem CID 3009957) has the molecular formula C14H23S+ and a molecular weight of 223.40 g/mol. Its IUPAC name is 1'-methylspiro[adamantane-2,3'-thiolan-1-ium].
| Compound Name | 1'-methylspiro[adamantane-2,3'-thiolan-1-ium] |
|---|---|
| PubChem CID | 3009957 |
| Molecular Formula | C14H23S+ |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 1'-methylspiro[adamantane-2,3'-thiolan-1-ium] |
| SMILES | C[S+]1CCC2(C1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C14H23S/c1-15-3-2-14(9-15)12-5-10-4-11(7-12)8-13(14)6-10/h10-13H,2-9H2,1H3/q+1 |
| InChIKey | QZRSUPHRARFSDC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|