C10H16S — CID 597731
4-thiatricyclo[5.2.2.02,6]undecane (PubChem CID 597731) has the molecular formula C10H16S and a molecular weight of 168.30 g/mol. Its IUPAC name is 4-thiatricyclo[5.2.2.02,6]undecane.
| Compound Name | 4-thiatricyclo[5.2.2.02,6]undecane |
|---|---|
| PubChem CID | 597731 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 4-thiatricyclo[5.2.2.02,6]undecane |
| SMILES | C1CC2CCC1C1CSCC21 |
| InChI | InChI=1S/C10H16S/c1-2-8-4-3-7(1)9-5-11-6-10(8)9/h7-10H,1-6H2 |
| InChIKey | UOSACYNCXLYJGL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |