C14H24S — CID 86219056
4,6-dimethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene (PubChem CID 86219056) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is 4,6-dimethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene.
| Compound Name | 4,6-dimethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene |
|---|---|
| PubChem CID | 86219056 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4,6-dimethyl-1,2,3,4,4a,5a,6,7,8,9,9a,9b-dodecahydrodibenzothiophene |
| SMILES | CC1CCCC2C3CCCC(C)C3SC12 |
| InChI | InChI=1S/C14H24S/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)15-13(9)11/h9-14H,3-8H2,1-2H3 |
| InChIKey | WJHOQEQKSDMUIC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |