C9H15FS — CID 44558396
5-fluoro-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene (PubChem CID 44558396) has the molecular formula C9H15FS and a molecular weight of 174.28 g/mol. Its IUPAC name is 5-fluoro-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene.
| Compound Name | 5-fluoro-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
|---|---|
| PubChem CID | 44558396 |
| Molecular Formula | C9H15FS |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-fluoro-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
| SMILES | CC1CSC2CCC(F)CC12 |
| InChI | InChI=1S/C9H15FS/c1-6-5-11-9-3-2-7(10)4-8(6)9/h6-9H,2-5H2,1H3 |
| InChIKey | LVGGJDOUVFOEDM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |