C15H26F2S — CID 145271629
7-fluoro-2-(1-fluoro-2-methylbutyl)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene (PubChem CID 145271629) has the molecular formula C15H26F2S and a molecular weight of 276.44 g/mol. Its IUPAC name is 7-fluoro-2-(1-fluoro-2-methylbutyl)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene.
| Compound Name | 7-fluoro-2-(1-fluoro-2-methylbutyl)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
|---|---|
| PubChem CID | 145271629 |
| Molecular Formula | C15H26F2S |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 7-fluoro-2-(1-fluoro-2-methylbutyl)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
| SMILES | CCC(C)C(F)C1SC2C(F)C(C)CCC2C1C |
| InChI | InChI=1S/C15H26F2S/c1-5-8(2)12(16)14-10(4)11-7-6-9(3)13(17)15(11)18-14/h8-15H,5-7H2,1-4H3 |
| InChIKey | GNVCONFHGWRHTP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |