C14H24F2S — CID 144922825
7-fluoro-2-(1-fluoro-2-methylpropyl)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene (PubChem CID 144922825) has the molecular formula C14H24F2S and a molecular weight of 262.41 g/mol. Its IUPAC name is 7-fluoro-2-(1-fluoro-2-methylpropyl)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene.
| Compound Name | 7-fluoro-2-(1-fluoro-2-methylpropyl)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
|---|---|
| PubChem CID | 144922825 |
| Molecular Formula | C14H24F2S |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 7-fluoro-2-(1-fluoro-2-methylpropyl)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
| SMILES | CC(C)C(F)C1SC2C(F)C(C)CCC2C1C |
| InChI | InChI=1S/C14H24F2S/c1-7(2)11(15)13-9(4)10-6-5-8(3)12(16)14(10)17-13/h7-14H,5-6H2,1-4H3 |
| InChIKey | HICUABQFXNUHPE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |