C10H18S — CID 59062056
(3aS,6R)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene (PubChem CID 59062056) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is (3aS,6R)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene.
| Compound Name | (3aS,6R)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
|---|---|
| PubChem CID | 59062056 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3aS,6R)-3,6-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
| SMILES | CC1CSC2C[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C10H18S/c1-7-3-4-9-8(2)6-11-10(9)5-7/h7-10H,3-6H2,1-2H3/t7-,8?,9+,10?/m1/s1 |
| InChIKey | GOGHCXFCTQQMLZ-RJQCTPFPSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |