C9H17S+ — CID 5256278
2-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophen-2-ium (PubChem CID 5256278) has the molecular formula C9H17S+ and a molecular weight of 157.30 g/mol. Its IUPAC name is 2-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophen-2-ium.
| Compound Name | 2-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophen-2-ium |
|---|---|
| PubChem CID | 5256278 |
| Molecular Formula | C9H17S+ |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 2-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophen-2-ium |
| SMILES | C[S+]1CC2CCCCC2C1 |
| InChI | InChI=1S/C9H17S/c1-10-6-8-4-2-3-5-9(8)7-10/h8-9H,2-7H2,1H3/q+1 |
| InChIKey | BJXOJFOAJUZUIV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|