C9H17IS — CID 13032528
2-iodo-2-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene (PubChem CID 13032528) has the molecular formula C9H17IS and a molecular weight of 284.21 g/mol. Its IUPAC name is 2-iodo-2-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene.
| Compound Name | 2-iodo-2-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
|---|---|
| PubChem CID | 13032528 |
| Molecular Formula | C9H17IS |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 2-iodo-2-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
| SMILES | CS1(I)CC2CCCCC2C1 |
| InChI | InChI=1S/C9H17IS/c1-11(10)6-8-4-2-3-5-9(8)7-11/h8-9H,2-7H2,1H3 |
| InChIKey | WRCNGNBPBHZOEA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|