C8H14S — CID 12602746
(7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene (PubChem CID 12602746) has the molecular formula C8H14S and a molecular weight of 142.27 g/mol. Its IUPAC name is (7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene.
| Compound Name | (7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
|---|---|
| PubChem CID | 12602746 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
| SMILES | C1CC[C@H]2CSCC2C1 |
| InChI | InChI=1S/C8H14S/c1-2-4-8-6-9-5-7(8)3-1/h7-8H,1-6H2/t7-,8?/m0/s1 |
| InChIKey | SJXUGVWKLLOJDR-JAMMHHFISA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |