C8H14OS — CID 565415
1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2-oxide (PubChem CID 565415) has the molecular formula C8H14OS and a molecular weight of 158.27 g/mol. Its IUPAC name is 1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2-oxide.
| Compound Name | 1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2-oxide |
|---|---|
| PubChem CID | 565415 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2-oxide |
| SMILES | O=S1CC2CCCCC2C1 |
| InChI | InChI=1S/C8H14OS/c9-10-5-7-3-1-2-4-8(7)6-10/h7-8H,1-6H2 |
| InChIKey | ORHJNBURJGDLAU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |