C8H16O2S — CID 20726816
2,2-dihydroxy-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene (PubChem CID 20726816) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is 2,2-dihydroxy-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene.
| Compound Name | 2,2-dihydroxy-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
|---|---|
| PubChem CID | 20726816 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2,2-dihydroxy-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
| SMILES | OS1(O)CC2CCCCC2C1 |
| InChI | InChI=1S/C8H16O2S/c9-11(10)5-7-3-1-2-4-8(7)6-11/h7-10H,1-6H2 |
| InChIKey | CVJSXPSUJUMHNR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |