C12H24S — CID 91147975
1,3-dimethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene;ethane (PubChem CID 91147975) has the molecular formula C12H24S and a molecular weight of 200.39 g/mol. Its IUPAC name is 1,3-dimethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene;ethane.
| Compound Name | 1,3-dimethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene;ethane |
|---|---|
| PubChem CID | 91147975 |
| Molecular Formula | C12H24S |
| Molecular Weight | 200.39 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1,3-dimethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene;ethane |
| SMILES | CC.CC1SC(C)C2CCCCC12 |
| InChI | InChI=1S/C10H18S.C2H6/c1-7-9-5-3-4-6-10(9)8(2)11-7;1-2/h7-10H,3-6H2,1-2H3;1-2H3 |
| InChIKey | HOSDYUXHRCAXCX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |