C9H16S — CID 573235
1-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene (PubChem CID 573235) has the molecular formula C9H16S and a molecular weight of 156.29 g/mol. Its IUPAC name is 1-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene.
| Compound Name | 1-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
|---|---|
| PubChem CID | 573235 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 1-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
| SMILES | CC1SCC2CCCCC21 |
| InChI | InChI=1S/C9H16S/c1-7-9-5-3-2-4-8(9)6-10-7/h7-9H,2-6H2,1H3 |
| InChIKey | QIOVUTWHCKLQAT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |