C8H14O2S-2 — CID 23535393
2,2-dioxido-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene (PubChem CID 23535393) has the molecular formula C8H14O2S-2 and a molecular weight of 174.26 g/mol. Its IUPAC name is 2,2-dioxido-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene.
| Compound Name | 2,2-dioxido-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
|---|---|
| PubChem CID | 23535393 |
| Molecular Formula | C8H14O2S-2 |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2,2-dioxido-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
| SMILES | [O-]S1([O-])CC2CCCCC2C1 |
| InChI | InChI=1S/C8H16O2S/c9-11(10)5-7-3-1-2-4-8(7)6-11/h7-10H,1-6H2/p-2 |
| InChIKey | CVJSXPSUJUMHNR-UHFFFAOYSA-L |
| XLogP | 1.87 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |