C9H14FS+ — CID 163997485
5-fluoro-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene (PubChem CID 163997485) has the molecular formula C9H14FS+ and a molecular weight of 173.28 g/mol. Its IUPAC name is 5-fluoro-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene.
| Compound Name | 5-fluoro-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
|---|---|
| PubChem CID | 163997485 |
| Molecular Formula | C9H14FS+ |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-fluoro-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
| SMILES | [CH2+]C1CC2CC(F)CCC2S1 |
| InChI | InChI=1S/C9H14FS/c1-6-4-7-5-8(10)2-3-9(7)11-6/h6-9H,1-5H2/q+1 |
| InChIKey | UFZJRIGWFCEDGL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|