C11H20S — CID 58030262
3-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene (PubChem CID 58030262) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is 3-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene.
| Compound Name | 3-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
|---|---|
| PubChem CID | 58030262 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 3-propan-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
| SMILES | CC(C)C1CSC2CCCCC21 |
| InChI | InChI=1S/C11H20S/c1-8(2)10-7-12-11-6-4-3-5-9(10)11/h8-11H,3-7H2,1-2H3 |
| InChIKey | ANEXKDPCADGRFN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |