C14H26S — CID 22095284
1,3,4,5,6,7-hexamethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene (PubChem CID 22095284) has the molecular formula C14H26S and a molecular weight of 226.43 g/mol. Its IUPAC name is 1,3,4,5,6,7-hexamethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene.
| Compound Name | 1,3,4,5,6,7-hexamethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
|---|---|
| PubChem CID | 22095284 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 1,3,4,5,6,7-hexamethyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene |
| SMILES | CC1SC(C)C2C(C)C(C)C(C)C(C)C12 |
| InChI | InChI=1S/C14H26S/c1-7-8(2)10(4)14-12(6)15-11(5)13(14)9(7)3/h7-14H,1-6H3 |
| InChIKey | VLOHAOBSAIDYJZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |