About 3-cyclohexylthiolane
3-cyclohexylthiolane (PubChem CID 598361) has the molecular formula C10H18S
and a molecular weight of 170.32 g/mol. Its IUPAC name is 3-cyclohexylthiolane.
Molecular Properties
| Compound Name | 3-cyclohexylthiolane |
| PubChem CID | 598361 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-cyclohexylthiolane |
| SMILES | C1CCC(C2CCSC2)CC1 |
| InChI | InChI=1S/C10H18S/c1-2-4-9(5-3-1)10-6-7-11-8-10/h9-10H,1-8H2 |
| InChIKey | PDIQZZLDSQSOJT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylthiolane?
The IUPAC name of 3-cyclohexylthiolane (CID 598361) is 3-cyclohexylthiolane.
What is the SMILES notation for 3-cyclohexylthiolane?
The canonical SMILES for 3-cyclohexylthiolane is C1CCC(C2CCSC2)CC1.
What is the InChIKey of 3-cyclohexylthiolane?
The InChIKey is PDIQZZLDSQSOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18S/c1-2-4-9(5-3-1)10-6-7-11-8-10/h9-10H,1-8H2.
What are the key properties of 3-cyclohexylthiolane?
3-cyclohexylthiolane has a molecular weight of 170.32 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylthiolane is sourced from PubChem (CID 598361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).