C10H16BF6N — CID 134906508
(Z)-5-[bis(trifluoromethyl)boranyl]-N,N,4-trimethylpent-3-en-2-amine (PubChem CID 134906508) has the molecular formula C10H16BF6N and a molecular weight of 275.05 g/mol. Its IUPAC name is (Z)-5-[bis(trifluoromethyl)boranyl]-N,N,4-trimethylpent-3-en-2-amine.
| Compound Name | (Z)-5-[bis(trifluoromethyl)boranyl]-N,N,4-trimethylpent-3-en-2-amine |
|---|---|
| PubChem CID | 134906508 |
| Molecular Formula | C10H16BF6N |
| Molecular Weight | 275.05 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (Z)-5-[bis(trifluoromethyl)boranyl]-N,N,4-trimethylpent-3-en-2-amine |
| SMILES | C/C(=C/C(C)N(C)C)CB(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H16BF6N/c1-7(5-8(2)18(3)4)6-11(9(12,13)14)10(15,16)17/h5,8H,6H2,1-4H3/b7-5- |
| InChIKey | GUGYMQGCWYZNGN-ALCCZGGFSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.05 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|