C13H22BF6N — CID 134906287
(Z)-5-[bis(trifluoromethyl)boranyl]-N,N-diethyl-3,4-dimethylpent-3-en-2-amine (PubChem CID 134906287) has the molecular formula C13H22BF6N and a molecular weight of 317.13 g/mol. Its IUPAC name is (Z)-5-[bis(trifluoromethyl)boranyl]-N,N-diethyl-3,4-dimethylpent-3-en-2-amine.
| Compound Name | (Z)-5-[bis(trifluoromethyl)boranyl]-N,N-diethyl-3,4-dimethylpent-3-en-2-amine |
|---|---|
| PubChem CID | 134906287 |
| Molecular Formula | C13H22BF6N |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (Z)-5-[bis(trifluoromethyl)boranyl]-N,N-diethyl-3,4-dimethylpent-3-en-2-amine |
| SMILES | CCN(CC)C(C)/C(C)=C(/C)CB(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H22BF6N/c1-6-21(7-2)11(5)10(4)9(3)8-14(12(15,16)17)13(18,19)20/h11H,6-8H2,1-5H3/b10-9- |
| InChIKey | DRDALQUAUASTOE-KTKRTIGZSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|