C12H20BF6N — CID 134906221
(Z)-4-[bis(trifluoromethyl)boranyl]-N,N-diethyl-2,3-dimethylbut-2-en-1-amine (PubChem CID 134906221) has the molecular formula C12H20BF6N and a molecular weight of 303.10 g/mol. Its IUPAC name is (Z)-4-[bis(trifluoromethyl)boranyl]-N,N-diethyl-2,3-dimethylbut-2-en-1-amine.
| Compound Name | (Z)-4-[bis(trifluoromethyl)boranyl]-N,N-diethyl-2,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 134906221 |
| Molecular Formula | C12H20BF6N |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (Z)-4-[bis(trifluoromethyl)boranyl]-N,N-diethyl-2,3-dimethylbut-2-en-1-amine |
| SMILES | CCN(CC)C/C(C)=C(/C)CB(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H20BF6N/c1-5-20(6-2)8-10(4)9(3)7-13(11(14,15)16)12(17,18)19/h5-8H2,1-4H3/b10-9- |
| InChIKey | JKRMRVSKUBSWLR-KTKRTIGZSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|