C11H18BF6N — CID 134906483
(Z)-4-[bis(trifluoromethyl)boranyl]-N,N-diethyl-3-methylbut-2-en-1-amine (PubChem CID 134906483) has the molecular formula C11H18BF6N and a molecular weight of 289.07 g/mol. Its IUPAC name is (Z)-4-[bis(trifluoromethyl)boranyl]-N,N-diethyl-3-methylbut-2-en-1-amine.
| Compound Name | (Z)-4-[bis(trifluoromethyl)boranyl]-N,N-diethyl-3-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 134906483 |
| Molecular Formula | C11H18BF6N |
| Molecular Weight | 289.07 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (Z)-4-[bis(trifluoromethyl)boranyl]-N,N-diethyl-3-methylbut-2-en-1-amine |
| SMILES | CCN(CC)C/C=C(/C)CB(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H18BF6N/c1-4-19(5-2)7-6-9(3)8-12(10(13,14)15)11(16,17)18/h6H,4-5,7-8H2,1-3H3/b9-6- |
| InChIKey | APQUMLSIIJZEKA-TWGQIWQCSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.07 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|